C18H25N3O — CID 97198876
(2R)-N-(cyclohexen-1-ylmethyl)-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide (PubChem CID 97198876) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (2R)-N-(cyclohexen-1-ylmethyl)-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide.
| Compound Name | (2R)-N-(cyclohexen-1-ylmethyl)-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 97198876 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (2R)-N-(cyclohexen-1-ylmethyl)-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(NCC1=CCCCC1)[C@@H](c1cccnc1)N1CCCC1 |
| InChI | InChI=1S/C18H25N3O/c22-18(20-13-15-7-2-1-3-8-15)17(21-11-4-5-12-21)16-9-6-10-19-14-16/h6-7,9-10,14,17H,1-5,8,11-13H2,(H,20,22)/t17-/m1/s1 |
| InChIKey | IFLRSCHMEJZHOM-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|