C20H24ClN3O2 — CID 74240297
N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide (PubChem CID 74240297) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 74240297 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide |
| SMILES | Cc1cccc(Cl)c1OCCNC(=O)C(c1cccnc1)N1CCCC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-15-6-4-8-17(21)19(15)26-13-10-23-20(25)18(24-11-2-3-12-24)16-7-5-9-22-14-16/h4-9,14,18H,2-3,10-13H2,1H3,(H,23,25) |
| InChIKey | XMYMKDSMKUXAPO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|