C18H24N4OS — CID 97208174
(2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide (PubChem CID 97208174) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide.
| Compound Name | (2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide |
|---|---|
| PubChem CID | 97208174 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide |
| SMILES | C[C@H](C(=O)NCCCc1csc(N)n1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H24N4OS/c1-13(22-10-8-14-5-2-3-6-15(14)11-22)17(23)20-9-4-7-16-12-24-18(19)21-16/h2-3,5-6,12-13H,4,7-11H2,1H3,(H2,19,21)(H,20,23)/t13-/m1/s1 |
| InChIKey | NXRVFOWRVOKHPM-CYBMUJFWSA-N |
| XLogP | 2.22 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|