C12H24Cl2N4OS2 — CID 163340668
(2R)-2-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-3-methylsulfanylbutanamide;dihydrochloride (PubChem CID 163340668) has the molecular formula C12H24Cl2N4OS2 and a molecular weight of 375.39 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-3-methylsulfanylbutanamide;dihydrochloride.
| Compound Name | (2R)-2-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-3-methylsulfanylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 163340668 |
| Molecular Formula | C12H24Cl2N4OS2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (2R)-2-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-3-methylsulfanylbutanamide;dihydrochloride |
| SMILES | CSC(C)(C)[C@H](N)C(=O)NCCCc1csc(N)n1.Cl.Cl |
| InChI | InChI=1S/C12H22N4OS2.2ClH/c1-12(2,18-3)9(13)10(17)15-6-4-5-8-7-19-11(14)16-8;;/h7,9H,4-6,13H2,1-3H3,(H2,14,16)(H,15,17);2*1H/t9-;;/m1../s1 |
| InChIKey | VUTVNNCXHKHDQF-KLQYNRQASA-N |
| XLogP | 2.09 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|