C19H24N6OS — CID 119060671
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-2-(quinazolin-4-ylamino)butanamide (PubChem CID 119060671) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-2-(quinazolin-4-ylamino)butanamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-2-(quinazolin-4-ylamino)butanamide |
|---|---|
| PubChem CID | 119060671 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methyl-2-(quinazolin-4-ylamino)butanamide |
| SMILES | CC(C)C(Nc1ncnc2ccccc12)C(=O)NCCCc1csc(N)n1 |
| InChI | InChI=1S/C19H24N6OS/c1-12(2)16(18(26)21-9-5-6-13-10-27-19(20)24-13)25-17-14-7-3-4-8-15(14)22-11-23-17/h3-4,7-8,10-12,16H,5-6,9H2,1-2H3,(H2,20,24)(H,21,26)(H,22,23,25) |
| InChIKey | BNOCVDKKMLCYFQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|