C19H24N6O — CID 124842175
(2R)-3-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]-2-(quinazolin-4-ylamino)butanamide (PubChem CID 124842175) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is (2R)-3-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]-2-(quinazolin-4-ylamino)butanamide.
| Compound Name | (2R)-3-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]-2-(quinazolin-4-ylamino)butanamide |
|---|---|
| PubChem CID | 124842175 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (2R)-3-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]-2-(quinazolin-4-ylamino)butanamide |
| SMILES | CC(C)[C@@H](Nc1ncnc2ccccc12)C(=O)NCCc1nccn1C |
| InChI | InChI=1S/C19H24N6O/c1-13(2)17(19(26)21-9-8-16-20-10-11-25(16)3)24-18-14-6-4-5-7-15(14)22-12-23-18/h4-7,10-13,17H,8-9H2,1-3H3,(H,21,26)(H,22,23,24)/t17-/m1/s1 |
| InChIKey | BRRHECVPFHRBJB-QGZVFWFLSA-N |
| XLogP | 2.16 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |