C14H26Cl2N4O2S — CID 163334584
(1S,3S,4S)-4-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methoxycyclohexane-1-carboxamide;dihydrochloride (PubChem CID 163334584) has the molecular formula C14H26Cl2N4O2S and a molecular weight of 385.36 g/mol. Its IUPAC name is (1S,3S,4S)-4-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methoxycyclohexane-1-carboxamide;dihydrochloride.
| Compound Name | (1S,3S,4S)-4-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methoxycyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 163334584 |
| Molecular Formula | C14H26Cl2N4O2S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (1S,3S,4S)-4-amino-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-methoxycyclohexane-1-carboxamide;dihydrochloride |
| SMILES | CO[C@H]1C[C@@H](C(=O)NCCCc2csc(N)n2)CC[C@@H]1N.Cl.Cl |
| InChI | InChI=1S/C14H24N4O2S.2ClH/c1-20-12-7-9(4-5-11(12)15)13(19)17-6-2-3-10-8-21-14(16)18-10;;/h8-9,11-12H,2-7,15H2,1H3,(H2,16,18)(H,17,19);2*1H/t9-,11-,12-;;/m0../s1 |
| InChIKey | QOROFKZFRHKWMS-UVEFGIHYSA-N |
| XLogP | 1.76 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|