C17H27N5O3S — CID 72935972
(3R,5S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide (PubChem CID 72935972) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is (3R,5S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72935972 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (3R,5S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide |
| SMILES | Nc1nc(CCCNC(=O)[C@H]2CNC[C@@H](C(=O)N3CCOCC3)C2)cs1 |
| InChI | InChI=1S/C17H27N5O3S/c18-17-21-14(11-26-17)2-1-3-20-15(23)12-8-13(10-19-9-12)16(24)22-4-6-25-7-5-22/h11-13,19H,1-10H2,(H2,18,21)(H,20,23)/t12-,13+/m1/s1 |
| InChIKey | JYIFSDAAPPDLRY-OLZOCXBDSA-N |
| XLogP | -0.14 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|