C11H17N3O2S — CID 91765036
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]oxolane-2-carboxamide (PubChem CID 91765036) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]oxolane-2-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 91765036 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]oxolane-2-carboxamide |
| SMILES | Nc1nc(CCCNC(=O)C2CCCO2)cs1 |
| InChI | InChI=1S/C11H17N3O2S/c12-11-14-8(7-17-11)3-1-5-13-10(15)9-4-2-6-16-9/h7,9H,1-6H2,(H2,12,14)(H,13,15) |
| InChIKey | ZVGYTGHCDRWCMR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|