C12H19N3O2S — CID 126432610
(2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-methyloxolane-2-carboxamide (PubChem CID 126432610) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is (2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-methyloxolane-2-carboxamide.
| Compound Name | (2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 126432610 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (2R)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-methyloxolane-2-carboxamide |
| SMILES | C[C@]1(C(=O)NCCCc2csc(N)n2)CCCO1 |
| InChI | InChI=1S/C12H19N3O2S/c1-12(5-3-7-17-12)10(16)14-6-2-4-9-8-18-11(13)15-9/h8H,2-7H2,1H3,(H2,13,15)(H,14,16)/t12-/m1/s1 |
| InChIKey | XQBRQZYGKKAOSI-GFCCVEGCSA-N |
| XLogP | 1.34 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|