C16H23N3OS — CID 110717869
N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]adamantane-1-carboxamide (PubChem CID 110717869) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110717869 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]adamantane-1-carboxamide |
| SMILES | Nc1nc(CCNC(=O)C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C16H23N3OS/c17-15-19-13(9-21-15)1-2-18-14(20)16-6-10-3-11(7-16)5-12(4-10)8-16/h9-12H,1-8H2,(H2,17,19)(H,18,20) |
| InChIKey | HATRUYKTTVVKAJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |