C17H24N2OS — CID 110739344
N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide (PubChem CID 110739344) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110739344 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide |
| SMILES | Cc1cnc(CCNC(=O)C23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C17H24N2OS/c1-11-10-19-15(21-11)2-3-18-16(20)17-7-12-4-13(8-17)6-14(5-12)9-17/h10,12-14H,2-9H2,1H3,(H,18,20) |
| InChIKey | KRIBWKDAIZENLN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |