C18H27N3O — CID 110717149
N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]adamantane-1-carboxamide (PubChem CID 110717149) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110717149 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]adamantane-1-carboxamide |
| SMILES | Cc1n[nH]c(C)c1CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H27N3O/c1-11-16(12(2)21-20-11)3-4-19-17(22)18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15H,3-10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | MGWBAMZWOBPPDF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |