C20H31N5O2S — CID 56562547
N-[3-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 56562547) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is N-[3-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 56562547 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[3-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | CCn1c(CCNC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)n[nH]c1=S |
| InChI | InChI=1S/C20H31N5O2S/c1-2-25-16(23-24-19(25)28)3-5-21-17(26)4-6-22-18(27)20-10-13-7-14(11-20)9-15(8-13)12-20/h13-15H,2-12H2,1H3,(H,21,26)(H,22,27)(H,24,28) |
| InChIKey | JHGMVYKZUYGSML-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|