C14H25N5OS — CID 122154802
1-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2-methylcyclohexyl)urea (PubChem CID 122154802) has the molecular formula C14H25N5OS and a molecular weight of 311.46 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2-methylcyclohexyl)urea.
| Compound Name | 1-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 122154802 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2-methylcyclohexyl)urea |
| SMILES | CCn1c(CCNC(=O)NC2CCCCC2C)n[nH]c1=S |
| InChI | InChI=1S/C14H25N5OS/c1-3-19-12(17-18-14(19)21)8-9-15-13(20)16-11-7-5-4-6-10(11)2/h10-11H,3-9H2,1-2H3,(H,18,21)(H2,15,16,20) |
| InChIKey | IEGBPVIMFYTOFW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|