C20H34N2O4 — CID 55407932
N-[3-[3-(2-methoxyethoxy)propylamino]-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 55407932) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is N-[3-[3-(2-methoxyethoxy)propylamino]-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[3-(2-methoxyethoxy)propylamino]-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55407932 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | N-[3-[3-(2-methoxyethoxy)propylamino]-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | COCCOCCCNC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H34N2O4/c1-25-7-8-26-6-2-4-21-18(23)3-5-22-19(24)20-12-15-9-16(13-20)11-17(10-15)14-20/h15-17H,2-14H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | MCUNLGDALTUVJR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|