C23H39N3O3 — CID 3221023
N-[1-[2-(3-ethoxypropylamino)-2-oxoethyl]piperidin-4-yl]adamantane-1-carboxamide (PubChem CID 3221023) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is N-[1-[2-(3-ethoxypropylamino)-2-oxoethyl]piperidin-4-yl]adamantane-1-carboxamide.
| Compound Name | N-[1-[2-(3-ethoxypropylamino)-2-oxoethyl]piperidin-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3221023 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | N-[1-[2-(3-ethoxypropylamino)-2-oxoethyl]piperidin-4-yl]adamantane-1-carboxamide |
| SMILES | CCOCCCNC(=O)CN1CCC(NC(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H39N3O3/c1-2-29-9-3-6-24-21(27)16-26-7-4-20(5-8-26)25-22(28)23-13-17-10-18(14-23)12-19(11-17)15-23/h17-20H,2-16H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | KEVWOMGQIXVUHG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|