C21H33N3O4 — CID 18120695
ethyl 4-[[2-(adamantane-1-carbonylamino)acetyl]amino]piperidine-1-carboxylate (PubChem CID 18120695) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl 4-[[2-(adamantane-1-carbonylamino)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(adamantane-1-carbonylamino)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18120695 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethyl 4-[[2-(adamantane-1-carbonylamino)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CNC(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C21H33N3O4/c1-2-28-20(27)24-5-3-17(4-6-24)23-18(25)13-22-19(26)21-10-14-7-15(11-21)9-16(8-14)12-21/h14-17H,2-13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | BEGSFICTZSSZPQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |