C11H21N3O2S — CID 113218404
ethyl 4-(ethylcarbamothioylamino)piperidine-1-carboxylate (PubChem CID 113218404) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is ethyl 4-(ethylcarbamothioylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(ethylcarbamothioylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113218404 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | ethyl 4-(ethylcarbamothioylamino)piperidine-1-carboxylate |
| SMILES | CCNC(=S)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C11H21N3O2S/c1-3-12-10(17)13-9-5-7-14(8-6-9)11(15)16-4-2/h9H,3-8H2,1-2H3,(H2,12,13,17) |
| InChIKey | BCGDQQGUXNITRX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|