C11H19BrN2O3 — CID 103693309
ethyl 4-(2-bromopropanoylamino)piperidine-1-carboxylate (PubChem CID 103693309) has the molecular formula C11H19BrN2O3 and a molecular weight of 307.19 g/mol. Its IUPAC name is ethyl 4-(2-bromopropanoylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(2-bromopropanoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103693309 |
| Molecular Formula | C11H19BrN2O3 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | ethyl 4-(2-bromopropanoylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C(C)Br)CC1 |
| InChI | InChI=1S/C11H19BrN2O3/c1-3-17-11(16)14-6-4-9(5-7-14)13-10(15)8(2)12/h8-9H,3-7H2,1-2H3,(H,13,15) |
| InChIKey | HYJHILNKVKUPEK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|