C12H22N4O4 — CID 43086420
ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]piperidine-1-carboxylate (PubChem CID 43086420) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43086420 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(C)C(=O)NC(N)=O)CC1 |
| InChI | InChI=1S/C12H22N4O4/c1-3-20-12(19)16-6-4-9(5-7-16)14-8(2)10(17)15-11(13)18/h8-9,14H,3-7H2,1-2H3,(H3,13,15,17,18) |
| InChIKey | NBRBPMLTIQJVPE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |