C12H20BrNO3 — CID 107904147
ethyl 4-(2-bromopropanoylamino)cyclohexane-1-carboxylate (PubChem CID 107904147) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is ethyl 4-(2-bromopropanoylamino)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(2-bromopropanoylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 107904147 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | ethyl 4-(2-bromopropanoylamino)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NC(=O)C(C)Br)CC1 |
| InChI | InChI=1S/C12H20BrNO3/c1-3-17-12(16)9-4-6-10(7-5-9)14-11(15)8(2)13/h8-10H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | KODSDXDPIVRGDT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|