C13H24N2O3 — CID 62638586
ethyl 4-[2-(methylamino)propanoylamino]cyclohexane-1-carboxylate (PubChem CID 62638586) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethyl 4-[2-(methylamino)propanoylamino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[2-(methylamino)propanoylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 62638586 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethyl 4-[2-(methylamino)propanoylamino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NC(=O)C(C)NC)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-4-18-13(17)10-5-7-11(8-6-10)15-12(16)9(2)14-3/h9-11,14H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | HFZJHDOFBARYFG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |