C27H37N3O4 — CID 3220815
ethyl 4-[[2-[4-(adamantane-1-carbonylamino)piperidin-1-yl]acetyl]amino]benzoate (PubChem CID 3220815) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(adamantane-1-carbonylamino)piperidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-(adamantane-1-carbonylamino)piperidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 3220815 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | ethyl 4-[[2-[4-(adamantane-1-carbonylamino)piperidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2CCC(NC(=O)C34CC5CC(CC(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C27H37N3O4/c1-2-34-25(32)21-3-5-22(6-4-21)28-24(31)17-30-9-7-23(8-10-30)29-26(33)27-14-18-11-19(15-27)13-20(12-18)16-27/h3-6,18-20,23H,2,7-17H2,1H3,(H,28,31)(H,29,33) |
| InChIKey | LKEIISBOIKRNHK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |