C27H30N4O4 — CID 3220881
ethyl 4-[[1-[2-(naphthalen-1-ylamino)-2-oxoethyl]piperidin-4-yl]carbamoylamino]benzoate (PubChem CID 3220881) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is ethyl 4-[[1-[2-(naphthalen-1-ylamino)-2-oxoethyl]piperidin-4-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[1-[2-(naphthalen-1-ylamino)-2-oxoethyl]piperidin-4-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 3220881 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | ethyl 4-[[1-[2-(naphthalen-1-ylamino)-2-oxoethyl]piperidin-4-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NC2CCN(CC(=O)Nc3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-2-35-26(33)20-10-12-21(13-11-20)28-27(34)29-22-14-16-31(17-15-22)18-25(32)30-24-9-5-7-19-6-3-4-8-23(19)24/h3-13,22H,2,14-18H2,1H3,(H,30,32)(H2,28,29,34) |
| InChIKey | ZKUZUIOVOKHQLK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |