C16H20F2N2O3 — CID 171701426
ethyl 4-[[2-(4,4-difluoropiperidin-1-yl)acetyl]amino]benzoate (PubChem CID 171701426) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is ethyl 4-[[2-(4,4-difluoropiperidin-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4,4-difluoropiperidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 171701426 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 4-[[2-(4,4-difluoropiperidin-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-2-23-15(22)12-3-5-13(6-4-12)19-14(21)11-20-9-7-16(17,18)8-10-20/h3-6H,2,7-11H2,1H3,(H,19,21) |
| InChIKey | GUZFSYZIQSPCPE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |