C18H26N2O4 — CID 97260580
ethyl 4-[[2-[(2R)-2-propan-2-ylmorpholin-4-yl]acetyl]amino]benzoate (PubChem CID 97260580) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 4-[[2-[(2R)-2-propan-2-ylmorpholin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2R)-2-propan-2-ylmorpholin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 97260580 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | ethyl 4-[[2-[(2R)-2-propan-2-ylmorpholin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2CCO[C@H](C(C)C)C2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-4-23-18(22)14-5-7-15(8-6-14)19-17(21)12-20-9-10-24-16(11-20)13(2)3/h5-8,13,16H,4,9-12H2,1-3H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | ACIFPKMORGNXSO-INIZCTEOSA-N |
| XLogP | 2.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |