C14H16N2O5 — CID 110686650
ethyl 4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]amino]benzoate (PubChem CID 110686650) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is ethyl 4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 110686650 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl 4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2CCOC2=O)cc1 |
| InChI | InChI=1S/C14H16N2O5/c1-2-20-13(18)10-3-5-11(6-4-10)15-12(17)9-16-7-8-21-14(16)19/h3-6H,2,7-9H2,1H3,(H,15,17) |
| InChIKey | UTEWHHKGRDLWKG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |