C23H33N3O4 — CID 54840863
ethyl 1-[2-[4-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 54840863) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethyl 1-[2-[4-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[4-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 54840863 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | ethyl 1-[2-[4-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC(=O)Nc2ccc(C(=O)NC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H33N3O4/c1-2-30-23(29)18-12-14-26(15-13-18)16-21(27)24-20-10-8-17(9-11-20)22(28)25-19-6-4-3-5-7-19/h8-11,18-19H,2-7,12-16H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | AALVQVXTYJUGNH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |