C16H21IN2O3 — CID 4818414
ethyl 1-[2-(3-iodoanilino)-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 4818414) has the molecular formula C16H21IN2O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is ethyl 1-[2-(3-iodoanilino)-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(3-iodoanilino)-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4818414 |
| Molecular Formula | C16H21IN2O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | ethyl 1-[2-(3-iodoanilino)-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC(=O)Nc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C16H21IN2O3/c1-2-22-16(21)12-6-8-19(9-7-12)11-15(20)18-14-5-3-4-13(17)10-14/h3-5,10,12H,2,6-9,11H2,1H3,(H,18,20) |
| InChIKey | OBPVLKLGABITDY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|