C23H28N2O4 — CID 54837787
ethyl 1-[2-oxo-2-(3-phenylmethoxyanilino)ethyl]piperidine-4-carboxylate (PubChem CID 54837787) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-(3-phenylmethoxyanilino)ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-(3-phenylmethoxyanilino)ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 54837787 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl 1-[2-oxo-2-(3-phenylmethoxyanilino)ethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC(=O)Nc2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-28-23(27)19-11-13-25(14-12-19)16-22(26)24-20-9-6-10-21(15-20)29-17-18-7-4-3-5-8-18/h3-10,15,19H,2,11-14,16-17H2,1H3,(H,24,26) |
| InChIKey | DCNFPXWULKGCGS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |