C25H34N2O4 — CID 8568957
[2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-(adamantane-1-carbonylamino)benzoate (PubChem CID 8568957) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-(adamantane-1-carbonylamino)benzoate.
| Compound Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-(adamantane-1-carbonylamino)benzoate |
|---|---|
| PubChem CID | 8568957 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-(adamantane-1-carbonylamino)benzoate |
| SMILES | CCC(C)(C)NC(=O)COC(=O)c1ccc(NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H34N2O4/c1-4-24(2,3)27-21(28)15-31-22(29)19-5-7-20(8-6-19)26-23(30)25-12-16-9-17(13-25)11-18(10-16)14-25/h5-8,16-18H,4,9-15H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | HBZXHRKFOYCCDB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |