C18H29NO3 — CID 71700197
7-(adamantane-1-carbonylamino)heptanoic acid (PubChem CID 71700197) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 7-(adamantane-1-carbonylamino)heptanoic acid.
| Compound Name | 7-(adamantane-1-carbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 71700197 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 7-(adamantane-1-carbonylamino)heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO3/c20-16(21)5-3-1-2-4-6-19-17(22)18-10-13-7-14(11-18)9-15(8-13)12-18/h13-15H,1-12H2,(H,19,22)(H,20,21) |
| InChIKey | WFBDSTDWDROYIK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|