C21H27NO3 — CID 18281096
phenyl 4-(adamantane-1-carbonylamino)butanoate (PubChem CID 18281096) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is phenyl 4-(adamantane-1-carbonylamino)butanoate.
| Compound Name | phenyl 4-(adamantane-1-carbonylamino)butanoate |
|---|---|
| PubChem CID | 18281096 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | phenyl 4-(adamantane-1-carbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)C12CC3CC(CC(C3)C1)C2)Oc1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c23-19(25-18-5-2-1-3-6-18)7-4-8-22-20(24)21-12-15-9-16(13-21)11-17(10-15)14-21/h1-3,5-6,15-17H,4,7-14H2,(H,22,24) |
| InChIKey | BTJWFVLLLSAJAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|