About phenyl 4-(methylamino)butanoate
phenyl 4-(methylamino)butanoate (PubChem CID 54754121) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is phenyl 4-(methylamino)butanoate.
Molecular Properties
| Compound Name | phenyl 4-(methylamino)butanoate |
| PubChem CID | 54754121 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | phenyl 4-(methylamino)butanoate |
| SMILES | CNCCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-12-9-5-8-11(13)14-10-6-3-2-4-7-10/h2-4,6-7,12H,5,8-9H2,1H3 |
| InChIKey | ODCPZRPVWLOUSH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-(methylamino)butanoate?
The IUPAC name of phenyl 4-(methylamino)butanoate (CID 54754121) is phenyl 4-(methylamino)butanoate.
What is the SMILES notation for phenyl 4-(methylamino)butanoate?
The canonical SMILES for phenyl 4-(methylamino)butanoate is CNCCCC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 4-(methylamino)butanoate?
The InChIKey is ODCPZRPVWLOUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-12-9-5-8-11(13)14-10-6-3-2-4-7-10/h2-4,6-7,12H,5,8-9H2,1H3.
What are the key properties of phenyl 4-(methylamino)butanoate?
phenyl 4-(methylamino)butanoate has a molecular weight of 193.25 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-(methylamino)butanoate is sourced from PubChem (CID 54754121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).