About phenyl 4-aminobutanoate
phenyl 4-aminobutanoate (PubChem CID 54753951) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is phenyl 4-aminobutanoate.
Molecular Properties
| Compound Name | phenyl 4-aminobutanoate |
| PubChem CID | 54753951 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | phenyl 4-aminobutanoate |
| SMILES | NCCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c11-8-4-7-10(12)13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2 |
| InChIKey | ZIOBXAULPKAHEE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-aminobutanoate?
The IUPAC name of phenyl 4-aminobutanoate (CID 54753951) is phenyl 4-aminobutanoate.
What is the SMILES notation for phenyl 4-aminobutanoate?
The canonical SMILES for phenyl 4-aminobutanoate is NCCCC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 4-aminobutanoate?
The InChIKey is ZIOBXAULPKAHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-8-4-7-10(12)13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2.
What are the key properties of phenyl 4-aminobutanoate?
phenyl 4-aminobutanoate has a molecular weight of 179.22 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-aminobutanoate is sourced from PubChem (CID 54753951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).