About phenyl 6-aminohexanoate
phenyl 6-aminohexanoate (PubChem CID 67610552) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is phenyl 6-aminohexanoate.
Molecular Properties
| Compound Name | phenyl 6-aminohexanoate |
| PubChem CID | 67610552 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | phenyl 6-aminohexanoate |
| SMILES | NCCCCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c13-10-6-2-5-9-12(14)15-11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,13H2 |
| InChIKey | ZIMOERCHELPKES-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 6-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 6-aminohexanoate?
The IUPAC name of phenyl 6-aminohexanoate (CID 67610552) is phenyl 6-aminohexanoate.
What is the SMILES notation for phenyl 6-aminohexanoate?
The canonical SMILES for phenyl 6-aminohexanoate is NCCCCCC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 6-aminohexanoate?
The InChIKey is ZIMOERCHELPKES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c13-10-6-2-5-9-12(14)15-11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,13H2.
What are the key properties of phenyl 6-aminohexanoate?
phenyl 6-aminohexanoate has a molecular weight of 207.27 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 6-aminohexanoate is sourced from PubChem (CID 67610552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).