About (4-phenoxyphenyl) 3-aminopropanoate
(4-phenoxyphenyl) 3-aminopropanoate (PubChem CID 94272044) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is (4-phenoxyphenyl) 3-aminopropanoate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl) 3-aminopropanoate |
| PubChem CID | 94272044 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (4-phenoxyphenyl) 3-aminopropanoate |
| SMILES | NCCC(=O)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15NO3/c16-11-10-15(17)19-14-8-6-13(7-9-14)18-12-4-2-1-3-5-12/h1-9H,10-11,16H2 |
| InChIKey | BGYXUANUZVZRGH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl) 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl) 3-aminopropanoate?
The IUPAC name of (4-phenoxyphenyl) 3-aminopropanoate (CID 94272044) is (4-phenoxyphenyl) 3-aminopropanoate.
What is the SMILES notation for (4-phenoxyphenyl) 3-aminopropanoate?
The canonical SMILES for (4-phenoxyphenyl) 3-aminopropanoate is NCCC(=O)Oc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of (4-phenoxyphenyl) 3-aminopropanoate?
The InChIKey is BGYXUANUZVZRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c16-11-10-15(17)19-14-8-6-13(7-9-14)18-12-4-2-1-3-5-12/h1-9H,10-11,16H2.
What are the key properties of (4-phenoxyphenyl) 3-aminopropanoate?
(4-phenoxyphenyl) 3-aminopropanoate has a molecular weight of 257.29 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl) 3-aminopropanoate is sourced from PubChem (CID 94272044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).