C26H32N2O2S — CID 24682641
N-[4-oxo-4-[[phenyl(thiophen-2-yl)methyl]amino]butyl]adamantane-1-carboxamide (PubChem CID 24682641) has the molecular formula C26H32N2O2S and a molecular weight of 436.62 g/mol. Its IUPAC name is N-[4-oxo-4-[[phenyl(thiophen-2-yl)methyl]amino]butyl]adamantane-1-carboxamide.
| Compound Name | N-[4-oxo-4-[[phenyl(thiophen-2-yl)methyl]amino]butyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 24682641 |
| Molecular Formula | C26H32N2O2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | N-[4-oxo-4-[[phenyl(thiophen-2-yl)methyl]amino]butyl]adamantane-1-carboxamide |
| SMILES | O=C(CCCNC(=O)C12CC3CC(CC(C3)C1)C2)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C26H32N2O2S/c29-23(28-24(22-8-5-11-31-22)21-6-2-1-3-7-21)9-4-10-27-25(30)26-15-18-12-19(16-26)14-20(13-18)17-26/h1-3,5-8,11,18-20,24H,4,9-10,12-17H2,(H,27,30)(H,28,29) |
| InChIKey | TYPPVHORDTYTNB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|