C21H21NOS2 — CID 24683529
4-phenylsulfanyl-N-[phenyl(thiophen-2-yl)methyl]butanamide (PubChem CID 24683529) has the molecular formula C21H21NOS2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 4-phenylsulfanyl-N-[phenyl(thiophen-2-yl)methyl]butanamide.
| Compound Name | 4-phenylsulfanyl-N-[phenyl(thiophen-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 24683529 |
| Molecular Formula | C21H21NOS2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-phenylsulfanyl-N-[phenyl(thiophen-2-yl)methyl]butanamide |
| SMILES | O=C(CCCSc1ccccc1)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H21NOS2/c23-20(14-8-15-24-18-11-5-2-6-12-18)22-21(19-13-7-16-25-19)17-9-3-1-4-10-17/h1-7,9-13,16,21H,8,14-15H2,(H,22,23) |
| InChIKey | GNTPOPKZSXUCFT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|