C17H19NO3S2 — CID 9344511
methyl 3-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]sulfanylpropanoate (PubChem CID 9344511) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is methyl 3-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 9344511 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | methyl 3-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(=O)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C17H19NO3S2/c1-21-16(20)9-11-22-12-15(19)18-17(14-8-5-10-23-14)13-6-3-2-4-7-13/h2-8,10,17H,9,11-12H2,1H3,(H,18,19)/t17-/m0/s1 |
| InChIKey | YOJWKRYNSAZYIR-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|