C20H21F2NO4S — CID 9344503
methyl 3-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl]sulfanylpropanoate (PubChem CID 9344503) has the molecular formula C20H21F2NO4S and a molecular weight of 409.45 g/mol. Its IUPAC name is methyl 3-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 9344503 |
| Molecular Formula | C20H21F2NO4S |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | methyl 3-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(=O)N[C@H](c1ccccc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H21F2NO4S/c1-26-18(25)11-12-28-13-17(24)23-19(14-5-3-2-4-6-14)15-7-9-16(10-8-15)27-20(21)22/h2-10,19-20H,11-13H2,1H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | LXFYUKLOOLJKIL-LJQANCHMSA-N |
| XLogP | 3.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|