C19H19F2NO5 — CID 9230220
[2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] 2-methoxyacetate (PubChem CID 9230220) has the molecular formula C19H19F2NO5 and a molecular weight of 379.36 g/mol. Its IUPAC name is [2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 9230220 |
| Molecular Formula | C19H19F2NO5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)N[C@@H](c1ccccc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H19F2NO5/c1-25-12-17(24)26-11-16(23)22-18(13-5-3-2-4-6-13)14-7-9-15(10-8-14)27-19(20)21/h2-10,18-19H,11-12H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | FZJYTOZMTWTYLD-SFHVURJKSA-N |
| XLogP | 2.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |