C19H19F2NO4 — CID 9015107
[2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] propanoate (PubChem CID 9015107) has the molecular formula C19H19F2NO4 and a molecular weight of 363.36 g/mol. Its IUPAC name is [2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] propanoate.
| Compound Name | [2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 9015107 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)N[C@@H](c1ccccc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H19F2NO4/c1-2-17(24)25-12-16(23)22-18(13-6-4-3-5-7-13)14-8-10-15(11-9-14)26-19(20)21/h3-11,18-19H,2,12H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | HWWWTNWPUYYKKZ-SFHVURJKSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |