C22H26F2N2O2 — CID 8558327
N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylpiperidin-1-yl)acetamide (PubChem CID 8558327) has the molecular formula C22H26F2N2O2 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylpiperidin-1-yl)acetamide.
| Compound Name | N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8558327 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylpiperidin-1-yl)acetamide |
| SMILES | CC1CCN(CC(=O)N[C@H](c2ccccc2)c2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H26F2N2O2/c1-16-11-13-26(14-12-16)15-20(27)25-21(17-5-3-2-4-6-17)18-7-9-19(10-8-18)28-22(23)24/h2-10,16,21-22H,11-15H2,1H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | XEFSQSKEESBFHW-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |