C21H23F2NO2S — CID 9342283
2-cyclopentylsulfanyl-N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]acetamide (PubChem CID 9342283) has the molecular formula C21H23F2NO2S and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 9342283 |
| Molecular Formula | C21H23F2NO2S |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]acetamide |
| SMILES | O=C(CSC1CCCC1)N[C@H](c1ccccc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H23F2NO2S/c22-21(23)26-17-12-10-16(11-13-17)20(15-6-2-1-3-7-15)24-19(25)14-27-18-8-4-5-9-18/h1-3,6-7,10-13,18,20-21H,4-5,8-9,14H2,(H,24,25)/t20-/m1/s1 |
| InChIKey | JKPHBRODMZEKER-HXUWFJFHSA-N |
| XLogP | 5.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |