C23H21F2NO3 — CID 9012238
N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylphenoxy)acetamide (PubChem CID 9012238) has the molecular formula C23H21F2NO3 and a molecular weight of 397.42 g/mol. Its IUPAC name is N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 9012238 |
| Molecular Formula | C23H21F2NO3 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)N[C@H](c2ccccc2)c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H21F2NO3/c1-16-7-11-19(12-8-16)28-15-21(27)26-22(17-5-3-2-4-6-17)18-9-13-20(14-10-18)29-23(24)25/h2-14,22-23H,15H2,1H3,(H,26,27)/t22-/m1/s1 |
| InChIKey | HLLFYLDDVOXXRE-JOCHJYFZSA-N |
| XLogP | 4.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |