C24H25NO3 — CID 8798273
2-(2-ethoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide (PubChem CID 8798273) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 8798273 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)N[C@H](c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25NO3/c1-3-27-21-11-7-8-12-22(21)28-17-23(26)25-24(19-9-5-4-6-10-19)20-15-13-18(2)14-16-20/h4-16,24H,3,17H2,1-2H3,(H,25,26)/t24-/m1/s1 |
| InChIKey | POJABANWQLVGLH-XMMPIXPASA-N |
| XLogP | 4.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |