C21H21NO3S — CID 8853848
2-(2-ethoxyphenoxy)-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 8853848) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 8853848 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H21NO3S/c1-2-24-17-11-6-7-12-18(17)25-15-20(23)22-21(19-13-8-14-26-19)16-9-4-3-5-10-16/h3-14,21H,2,15H2,1H3,(H,22,23)/t21-/m1/s1 |
| InChIKey | YEYCCDVWORRSJB-OAQYLSRUSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |