C23H23NO3S — CID 9230022
[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] (2S)-2-phenylbutanoate (PubChem CID 9230022) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] (2S)-2-phenylbutanoate.
| Compound Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 9230022 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)N[C@H](c1ccccc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-2-19(17-10-5-3-6-11-17)23(26)27-16-21(25)24-22(20-14-9-15-28-20)18-12-7-4-8-13-18/h3-15,19,22H,2,16H2,1H3,(H,24,25)/t19-,22+/m0/s1 |
| InChIKey | CKBFWWQOZJWPOM-SIKLNZKXSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |